1-Acryloyloxy-3-hydroxyadamantane is a chemical compound identified as a pharmaceutical intermediate, featuring both an acrylate ester and a hydroxyl group attached to an adamantane core. Its significance lies in its role as a building block for the synthesis of more complex pharmaceutical agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 216581-76-9
(R)-tert-Butyl oxirane-2-carboxylate
Pharmaceutical intermediate for synthesis
Tert-Butyl (4R)-3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate
pharmaceutical intermediate
Tert-Butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate
pharmaceutical intermediate
Tert-Butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate
Boc-protected chiral amine intermediate
(3-hydroxy-1-adamantyl) prop-2-enoate
DKDKCSYKDZNMMA-UHFFFAOYSA-N
C=CC(=O)OC12CC3CC(C1)CC(C3)(C2)O