Methyl 3,5-dimethoxybenzoate is a chemical compound characterized by an aromatic ring bearing ester and ether functional groups. It is primarily significant as an intermediate in the synthesis of other chemical products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2150-37-0
3-(2,3-dihydrobenzo[b]furan-5-yl)propanoic acid
Pharmaceutical intermediate
5-Chloro-2-furaldehyde
Pharmaceutical intermediate for synthesis
8-Bromo-6-methylquinazolin-4(3H)-one
pharmaceutical intermediate
4-Aminomethyl-pyrrolidin-3-one-methyloxime 2HCl
Pharmaceutical intermediate building block
methyl 3,5-dimethoxybenzoate
YXUIOVUOFQKWDM-UHFFFAOYSA-N
COC1=CC(=CC(=C1)C(=O)OC)OC