This compound is a pharmaceutical intermediate used in the synthesis of efavirenz, a non-nucleoside reverse transcriptase inhibitor. It is characterized by the presence of an aromatic ring, an alcohol group, and a carbamate ester moiety.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 211563-41-6
3-(Trifluoromethyl)benzenepropanal
pharmaceutical intermediate
Abiraterone Impurity N1
Abiraterone intermediate impurity
6-bromopyridine-2-carboxylic acid
pharmaceutical intermediate
Ethyl 6-bromopicolinate
pharmaceutical intermediate
Efavirenz aminoalcohol
Efavirenz intermediate
ethyl N-[4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl]phenyl]carbamate
BZIKLWWRUOKZMC-HNNXBMFYSA-N
CCOC(=O)NC1=C(C=C(C=C1)Cl)[C@@](C#CC2CC2)(C(F)(F)F)O