This compound is a PEG-based conjugation reagent featuring an N-hydroxysuccinimide (NHS) ester group and a protected amine functionality. It is commonly used in bioconjugation chemistry for the attachment of molecules to primary amines under mild conditions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2101206-31-7
Ald-Ph-amido-PEG2-C2-Pfp ester
research reagent for bioconjugation
((2,4-dimethylphenyl)diazenyl)(3-methoxyphenyl)methanone
research compound
5-fluoropyridin-3-amine
research compound
2,6-dibromo-3,5-difluoropyridine
Research reagent for organic synthesis
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]propanoate
UXABBPKGOKMLNT-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCON2C(=O)C3=CC=CC=C3C2=O