This compound is a research chemical characterized by a complex structure containing benzothiazole and thiadiazole rings. It is primarily used as a laboratory reagent for chemical and biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 209467-59-4
Sodium 4,4'-((3,5-dimethylphenyl)azanediyl)bis(butane-1-sulfonate)
research compound
5'-O-(4,4'-Dimethoxytrityl)-5-methoxyuridine
protected nucleoside for oligonucleotide synthesis
(2R)-1-[(tert-butoxy)carbonyl]-4-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperazine-2-carboxylic acid
Research compound for peptide synthesis
2-Aminoadenosine
Purine nucleoside research reagent
S-(1,3-benzothiazol-2-yl) (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoethanethioate
OOEJURIZMJWXJB-NQUVTRGKSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O/N=C(/C4=NSC(=N4)N)\C(=O)SC5=NC6=CC=CC=C6S5
—