This compound is a spirobifluorene derivative with multiple triarylamine and methoxy substituents, characterized by a high molecular weight and 14 ring systems. It is primarily used as a hole transport material in solar cell research due to its aromatic, amine-containing structure.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 207739-72-8
Manganese(II) Bis(trifluoromethanesulfonyl)imide
lithium-ion battery electrolyte additive
Benzene, 5-[difluoro[(trans,trans)-4'-propyl[1,1'-bicyclohexyl]-4-yl]methoxy]-1,2,3-trifluoro-
liquid crystal intermediate
N-(4-(Naphthalen-2-yl)phenyl)naphthalen-2-amine
electronic material
4-(naphthalen-2-yl)aniline
OLED intermediate chemical
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
XDXWNHPWWKGTKO-UHFFFAOYSA-N
COC1=CC=C(C=C1)N(C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)C5=C(C46C7=C(C=CC(=C7)N(C8=CC=C(C=C8)OC)C9=CC=C(C=C9)OC)C1=C6C=C(C=C1)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC)C=C(C=C5)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC