This compound is a peptide-like molecule featuring a pyrrolidine ring and a cyclohexyl group, with multiple functional groups including an acid, amide, amine, ester, and ether. It is primarily used as a research compound in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2055735-10-7
8-Bromo-1-chlorodibenzo[b,d]thiophene
Research reagent for synthetic chemistry
MC-Val-Cit-PAB-Auristatin E
antibody-drug conjugate linker payload
MC-Val-Cit-PAB-duocarmycin
antibody drug conjugate linker payload
DCTP
nucleotide triphosphate for DNA synthesis
Lisinopril specified impurity F
pharmaceutical impurity reference standard
(2S)-1-[(2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid
ZARBDUSKHGGCSR-XIRDDKMYSA-N
CCOC(=O)[C@H](CCC1CCCCC1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O