2-Chloro-4-iodo-6-(trifluoromethyl)pyridine is a halogenated pyridine derivative used as a research compound. Its structure features a pyridine ring substituted with chlorine, iodine, and a trifluoromethyl group, giving it distinctive chemical properties for laboratory investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 205444-22-0
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
Chain transfer agent for RAFT polymerization
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid
PEG-linked maleimide reagent for conjugation
(3-(difluoromethoxy)-5-fluorophenyl)boronic acid
research reagent for chemical synthesis
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
JHKQSKCFLAXPKK-UHFFFAOYSA-N
C1=C(C=C(N=C1C(F)(F)F)Cl)I