5-Nitronicotinic acid is a research compound featuring a pyridine ring substituted with a carboxylic acid and a nitro group. It is used primarily as a laboratory reagent for chemical synthesis and studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2047-49-6
Methyl 4-fluoro-2-methoxybenzoate
research compound
3-Acetylphenylboronic acid
Boronic acid research reagent
DI-I-PROPYLPHOSPHINE
organophosphorus research reagent
(R)-[(RUCL(H8-BINAP))2(MU-CL)3][NH2ME2]
asymmetric hydrogenation catalyst
5-nitropyridine-3-carboxylic acid
TZAGBVHIUUFVCJ-UHFFFAOYSA-N
C1=C(C=NC=C1[N+](=O)[O-])C(=O)O