This compound is a pharmaceutical intermediate specifically used in the synthesis of oseltamivir, an antiviral medication for influenza. Its structure includes an ester, amide, and ether functional groups, contributing to its role in manufacturing processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 204255-06-1
Methyl 2-Fluoro-4-iodobenzoate
Pharmaceutical intermediate for synthesis
N-Nitroso Maprotiline
Nitrosamine impurity standard for pharmaceuticals
ZINC HYDROXIDE
pharmaceutical intermediate
Fmoc-Dap(Z)-OH
Pharmaceutical intermediate for peptide synthesis
ethyl (3R,4R,5S)-4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate
MPTCBJSPQVJIPZ-RRFJBIMHSA-N
CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)N=[N+]=[N-])C(=O)OCC