Chlorotri(methyl-d3)silane is a deuterated chlorosilane compound used as a research reagent. Its primary significance lies in serving as a stable isotope-labeled building block for synthetic chemistry and materials science studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20395-57-7
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
D-Arginine, N2-((1,1-dimethylethoxy)carbonyl)-, monohydrochloride, monohydrate
Research reagent for peptide synthesis
THIOPHENE-2,5-D2
deuterated research compound
(R)-1-(3-(3-Amino-6-(2-fluoro-5-isopropoxyphenyl)pyrazine-2-carboxamido)pyridin-4-yl)piperidine-3-carboxylic acid
research compound
Chlorotrimethylsilane
Silylating agent and silicone intermediate
chloro-tris(trideuteriomethyl)silane
IJOOHPMOJXWVHK-GQALSZNTSA-N
[2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl