This compound is a fluorinated pyrrolidine derivative with a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid moiety. It is a research compound used in laboratory and manufacturing settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 203866-13-1
3-Methoxyphenethylamine
Research compound
Methyl 3-phenanthryl ketone
research compound
4-BROMOSTYRENE
research compound for synthesis
5-Chloropentyl acetate
chemical intermediate
(2S,4R)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4S)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4R)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
YGWZXQOYEBWUTH-BQBZGAKWSA-N
CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)F