This compound is a photoaffinity labeling reagent featuring two azide groups attached to aromatic rings, which can be activated by light to form covalent bonds with target biomolecules. It is primarily used in research to study molecular interactions and identify binding sites on proteins.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20237-98-3
2-BROMOBUTANE-D9
Deuterated research compound
3,4-Dimethoxybenzonitrile
research compound
(+/-)-1,2-Propylene-d6 Oxide
Deuterated reference standard for NMR
Chloramphenicol D5
Deuterated analytical reference standard
(2E,6E)-2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one
UZNOMHUYXSAUPB-UNZYHPAISA-N
C1C/C(=C\C2=CC=C(C=C2)N=[N+]=[N-])/C(=O)/C(=C/C3=CC=C(C=C3)N=[N+]=[N-])/C1
—