Adenosine-1'-13C is a labeled reference standard of adenosine, where the carbon atom at the 1' position of the ribose moiety is replaced with the stable isotope carbon-13. This compound is used primarily as an analytical reference material for quantification and identification in research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 201996-55-6
4-Aminobenzoic Acid-d4
labeled reference standard
2-PHENYLPROPANE-1,1,1,3,3,3-D6
deuterated research standard
Ethyl 3-(2-bromophenyl)-2-oxopropanoate
Research chemical reagent
2-(dimethylamino)ethyl 2-(m-tolyloxy)acetate
research compound
(5-Cyano-1H-indol-1-yl)acetic acid
Research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
Adenosine-5'-13C
isotopic labeled reference standard
Vidarabine
active pharmaceutical ingredient
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)(213C)oxolane-3,4-diol
OIRDTQYFTABQOQ-OGIWRBOVSA-N
C1=NC(=C2C(=N1)N(C=N2)[13C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N