This compound is a lithium salt of a thiazole-containing amino acid derivative, used as a pharmaceutical intermediate. Its structure features a stereocenter and an aromatic heterocyclic ring, making it suitable for incorporation into complex synthetic pathways.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 201409-23-6
N-((N-Methyl-N-((2-isopropyl-4-thiazolyl)methyl)amino)carbonyl)-L-valine Methyl Ester
analytical reference standard
3-((Acetamidomethyl)sulfanyl)-N-(((9H-fluoren-9-yl)methoxy)carbonyl)-L-valine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Pen(Trt)-OH
Peptide synthesis building block
Diethyl dichloromalonate
pharmaceutical intermediate
N-Acetyl-S-(2-carboxyethyl)-L-cysteine Bis(dicyclohexylamine) Salt
N-acetylcysteine impurity reference standard
Ureidovaline
n.a
lithium (2S)-3-methyl-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoate
GXHCKLLMMZHJOG-MERQFXBCSA-M
[Li+].CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)[O-]