This compound is an organic molecule featuring two alcohol groups attached to a benzene ring via isopropyl linkers. It is described in the literature as a diol derivative of diisopropylbenzene, commonly used in coordination chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1999-85-5
2-[3-(2-hydroxypropan-2-yl)phenyl]propan-2-ol
UGPWRRVOLLMHSC-UHFFFAOYSA-N
CC(C)(C1=CC(=CC=C1)C(C)(C)O)O