Trifloxysulfuron-sodium is a sulfonylurea herbicide that inhibits acetolactate synthase (ALS), an enzyme essential for the biosynthesis of branched-chain amino acids in plants. It is a systemic compound that moves throughout plant tissue, causing susceptible broadleaf weeds to stop growing soon after application, with death and decomposition occurring over several weeks.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 199119-58-9
sodium (4,6-dimethoxypyrimidin-2-yl)carbamoyl-[[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]sulfonyl]azanide
UFEIWEXHHOXPGP-UHFFFAOYSA-M
COC1=CC(=NC(=N1)NC(=O)[N-]S(=O)(=O)C2=C(C=CC=N2)OCC(F)(F)F)OC.[Na+]