This compound is a research reagent with a complex polycyclic structure containing multiple heterocyclic rings and aromatic groups. It features a specific stereochemical configuration that distinguishes it from related molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1985607-70-2
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
Nicotinamide N-oxide
research compound for crystal engineering
HIV (gp120) Antigenic Peptide trifluoroacetate salt
HIV antigenic peptide reagent
2-Piperidinecarboxamide
Research compound
7-(Benzyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione
Pharmaceutical intermediate for baloxavir marboxil
(3R)-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione
HJTRSKVIYMCKJU-AWEZNQCLSA-N
C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2)OCC4=CC=CC=C4