1,4-Benzenedicarboxylic acid, bis(phenylmethyl) ester, also known as This compound, is an industrial chemical primarily used as a plasticizer intermediate for polymers. It features a structure with two ester groups and aromatic rings, contributing to its role in polymer manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 19851-61-7
بنزوات البنزيل
scabicide and insect repellent
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
4-HEPTYLPHENOL
Alkylphenol intermediate for industrial synthesis
2,6-Diisopropyl-1,4-benzoquinone
benzoquinone derivative for chemical synthesis
N,N,N-trimethylcyclohexanaminium hydroxide
phase transfer catalyst
2-CHLORO-4-FLUOROPHENOL
chemical intermediate for synthesis
dibenzyl benzene-1,4-dicarboxylate
IWGFEQWCMAADJZ-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)C(=O)OCC3=CC=CC=C3