(2-azido-3-pyridyl)-pentafluoro-sulfane is a research compound featuring an azido group attached to a pyridine ring bearing a pentafluoro-λ6-sulfane substituent. Its structure includes both aromatic and heterocyclic elements, and it is primarily used in laboratory research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1982380-93-7
N-benzyl-5-(pentafluoro-sulfanyl)pyridin-2-amine
research compound
N-benzyl-6-fluoro-5-(pentafluoro-sulfanyl)pyridin-2-amine
research compound
(6-benzyloxy-2-fluoro-3-pyridyl)-pentafluoro-sulfane
research compound
6-hydroxypyridine-2,5-dicarboxylic acid
research compound
(2-azido-3-pyridinyl)-pentafluoro-lambda6-sulfane
LNRDDYHSTCALHC-UHFFFAOYSA-N
C1=CC(=C(N=C1)N=[N+]=[N-])S(F)(F)(F)(F)F
—