PQ 401 is a research compound that acts as an antagonist of the insulin-like growth factor 1 receptor (IGF-1R). It is a member of the quinoline chemical class and is used primarily in laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 196868-63-0
(R)-(+)-2-Methyl-2-propanesulfinamide
chiral auxiliary for asymmetric synthesis
2-methylpyrimidine-4,6-diamine
research compound
2,4-Dichlorophenylacetic acid
research compound
Diethyl azodicarboxylate
Reagent in synthetic organic chemistry
1-(5-chloro-2-methoxyphenyl)-3-(2-methylquinolin-4-yl)urea
YBLWOZUPHDKFOT-UHFFFAOYSA-N
CC1=NC2=CC=CC=C2C(=C1)NC(=O)NC3=C(C=CC(=C3)Cl)OC