4-Bromo-2,3-difluorobenzoic acid is a halogenated aromatic carboxylic acid used as a pharmaceutical intermediate in chemical synthesis. Its structure features a bromine atom and two fluorine substituents on the benzene ring, along with a carboxylic acid group, contributing to its utility in building more complex organic molecules for drug development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 194804-91-6
4-Fluoro-2-(trifluoromethyl)benzonitrile
pharmaceutical intermediate
Methoxyacetic anhydride
Pharmaceutical intermediate for decitabine
1H-1,2,4-Triazole-1-carboximidamide hydrochloride
Pharmaceutical intermediate for antiviral synthesis
1-amino-N-[6-cyano-5-(trifluoromethyl)-3-pyridyl]cyclobutanecarboxamide
Pharmaceutical intermediate
4-bromo-2,3-difluorobenzoic acid
IRUDFVTZXQTEFN-UHFFFAOYSA-N
C1=CC(=C(C(=C1C(=O)O)F)F)Br