2-Fluoro-4-methyl-5-nitropyridine is a chemical compound commonly employed as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients. Its structure features a pyridine ring with fluorine, methyl, and nitro substituents, contributing to its utility in laboratory and industrial chemical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 19346-47-5
2-Chlorophenyl chloroformate
Pharmaceutical intermediate for synthesis
(2H8)Styrene
Deuterated styrene for pharmaceutical intermediate
Tert-Butyl 3,3-difluoro-1,2,3,6-tetrahydropyridine-1-carboxylate
Pharmaceutical intermediate
(3R)-1-{[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}PIPERIDINE-3-CARBOXYLIC ACID
Fmoc-protected amino acid intermediate
2-fluoro-4-methyl-5-nitropyridine
NSKQWXVTBOPEMH-UHFFFAOYSA-N
CC1=CC(=NC=C1[N+](=O)[O-])F