This compound is a synthetic peptide used as an active pharmaceutical ingredient in pharmaceutical research and manufacturing. Its structure includes multiple amino acid residues, amide bonds, and aromatic rings, contributing to its complex molecular architecture.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1926163-20-3
(Des-Gly10,D-Trp3,D-Leu6,Pro-NHEt9)-LHRH Trifluoroacetate
LHRH analog active pharmaceutical ingredient
Leuprolide EP impurity D
reference standard for pharmaceutical impurity
Goserelin Impurity G
goserelin impurity reference standard
(D-Ser(tBu)6,D-Leu7,Azagly10)-LHRH
LHRH analog peptide
Buserelin EP Impurity B
Active pharmaceutical ingredient reference standard
Etilamide
GnRH agonist therapeutic peptide
Buserelin acetate
active pharmaceutical ingredient
(Des-Gly10,D-Tyr5,D-Ser(tBu)6,Pro-NHEt9)-LHRH Acetate
LHRH agonist therapeutic peptide
(2R)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
CUWODFFVMXJOKD-UUVJJVFOSA-N
CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@H]6CCC(=O)N6