(2-(Benzyloxy)phenyl)boronic acid is a boronic acid derivative containing a benzyl ether group. It is primarily used as a synthetic building block in cross-coupling reactions for laboratory and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 190661-29-1
Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate
synthetic building block for cross-coupling
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
Lithium 2-methylpropan-2-olate
strong base reagent
Piperidinium, 1,1-diethyl-2,6-dimethyl-, bromide
structure directing agent
4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane
research compound
2-BROMOTRIPHENYLENE
research compound
(2-phenylmethoxyphenyl)boronic acid
MCAIDINWZOCYQK-UHFFFAOYSA-N
B(C1=CC=CC=C1OCC2=CC=CC=C2)(O)O