2-(3,5-dibromophenyl)acetic acid is a research compound featuring a phenyl ring substituted with two bromine atoms and an acetic acid side chain. Its relatively low molecular weight and moderate lipophilicity make it suitable for laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 188347-49-1
3,5-Diiodo-L-tyrosine dihydrate
research reagent for tyrosine derivatives
22Z-Paricalcitol
research compound
3,4-dichloropyridin-2-amine
research compound
Tetrakis(2,2,6,6-tetramethylheptane-3,5-dionato)zirconium
volatile metal precursor for thin films
2-(3,5-dibromophenyl)acetic acid
NTQNLWCPZSORSR-UHFFFAOYSA-N
C1=C(C=C(C=C1Br)Br)CC(=O)O