5-Chloro-3-sulfinothiophene-2-carboxylic acid is a chemical compound featuring a thiophene ring substituted with chlorine, carboxylic acid, and sulfinic acid groups. It is listed as a research compound and pharmaceutical intermediate.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 187746-97-0
5-chloro-3-sulfinothiophene-2-carboxylic acid
BHNLEKOHMPGJAH-UHFFFAOYSA-N
C1=C(SC(=C1S(=O)O)C(=O)O)Cl