Dacisteine is an N-acyl-L-amino acid and a small molecule compound used as an active pharmaceutical ingredient. It features amide and carboxylic acid functional groups, with a molecular weight of approximately 205 Da.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18725-37-6
Elimusertib
active pharmaceutical ingredient
2(1H)-pyrimidinone, tetrahydro-4-hydroxy-1-beta-D-ribofuranosyl-
nucleotide metabolism inhibitor
Derquantel
anthelmintic active pharmaceutical ingredient
Abacavir sulfate
active pharmaceutical ingredient
(2R)-2-acetamido-3-acetylsulfanylpropanoic acid
HSPYGHDTVQJUDE-LURJTMIESA-N
CC(=O)N[C@@H](CSC(=O)C)C(=O)O