Diphenylacetyl chloride is a chemical compound used as an intermediate in organic synthesis. It features two aromatic rings and a reactive acyl chloride group, making it useful for introducing the diphenylacetyl moiety into target molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1871-76-7
Diethylenetriaminepentaacetic dianhydride
Chemical synthesis intermediate
7-Octenoic acid
Research reagent
4,4,5,5-tetramethyl-2-[2-(3-phenylphenyl)phenyl]-1,3,2-dioxaborolane
research reagent for organic synthesis
3-Bromo-4'-iodo-1,1'-biphenyl
Research compound
3-Bromo-3'-iodo-1,1'-biphenyl
research compound
2,2-diphenylacetyl chloride
MSYLETHDEIJMAF-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)Cl