This compound is a diester featuring both ester and nitrile functional groups, commonly used as a pharmaceutical intermediate. Its structure includes two ethyl ester groups and a cyano-substituted alkyl chain, contributing to its role in chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 186038-82-4
6-fluoro-2-methyl-3-nitropyridine
Pharmaceutical intermediate
Sodium 2-cyanopyridine-3-sulfinate
Pharmaceutical intermediate
Tert-Butyl [3-(trifluoromethyl)pyrrolidin-3-yl]carbamate
Pharmaceutical intermediate for drug synthesis
1,2-Bis(methanesulfonyloxymethyl)cyclohexane, (1R,2R)-
Pharmaceutical intermediate
diethyl 2-(1-cyano-3-methylbutyl)propanedioate
PZGIWBPMOSUKEV-UHFFFAOYSA-N
CCOC(=O)C(C(CC(C)C)C#N)C(=O)OCC