1,2-O-Isopropylidene-alpha-D-glucofuranose is a protected sugar derivative commonly employed as a pharmaceutical intermediate in organic synthesis. Its structure features a fused ring system with multiple alcohol and ether groups, making it a versatile building block for preparing more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18549-40-1
(3R,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diyl bis(4-hydroxybenzoate)
Pharmaceutical intermediate
Dihydro-4-(2-methylpropyl)-2H-Pyran-2,6(3H)-dione
Pharmaceutical intermediate
2-(((3aR,4S,6R,6aS)-6-(7-Amino-5-(propylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyltetrahydro-4H-cyclopenta[d][1,3]dioxol-4-yl)oxy)ethan-1-ol
Pharmaceutical impurity reference standard
3-Amino-2-methylbenzoic Acid Methyl Ester
pharmaceutical intermediate
((3aR,5S,6aR)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol
research compound
(1R)-1-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol
BGGCXQKYCBBHAH-OZRXBMAMSA-N
CC1(O[C@@H]2[C@H]([C@H](O[C@@H]2O1)[C@@H](CO)O)O)C