This compound is a boronic ester derivative of benzoic acid, commonly used as a pharmaceutical intermediate. Its structure features a dioxaborolane ring attached to a benzoic acid moiety, making it suitable for carbon-carbon bond formation in drug synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 180516-87-4
N-alpha-(9-Fluorenylmethyloxycarbonyl)-N-beta-trityl-D-asparagine
Peptide synthesis building block
1,1-Cyclopentanedicarboxylic acid, 3-oxo-, diethyl ester
pharmaceutical intermediate
METHYL N-CBZ-PIPERIDINE-2-CARBOXYLATE
Peptide synthesis protecting group intermediate
2,6-Difluorobenzoyl chloride
Pharmaceutical intermediate for synthesis
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
IYDKBQIEOBXLTP-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O
—