This compound is a deuterated research reagent, specifically a stable isotope-labeled analog of 3-diethylamino acetaminophen. It is primarily used as an analytical standard or internal standard in mass spectrometry and other quantitative analytical methods.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1794789-22-2
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride)
Deuterated research compound
2-BROMOBUTANE-D9
Deuterated research compound
1-Methylimidazole-d6
Deuterated research compound
Clenpenterol-d5 Hydrochloride
Deuterated analytical reference standard
Acetaminophen Dimer-d6
isotope-labeled research compound
2-Phenylbutyric Acid-d5 Methyl Ester
deuterated research standard
Aceclofenac-d4,13C2 (major)
Isotope-labeled analytical reference standard
N-[3-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-hydroxyphenyl]acetamide
BOUCRWJEKAGKKG-IZUSZFKNSA-N
[2H]C([2H])([2H])C([2H])([2H])N(CC1=C(C=CC(=C1)NC(=O)C)O)C([2H])([2H])C([2H])([2H])[2H]
—