This compound is a protected proline derivative featuring an unsaturated pyrrole ring and tert-butyloxycarbonyl (Boc) and ethyl ester functional groups. It is primarily used as a pharmaceutical intermediate in the synthesis of complex organic molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 178172-26-4
1-N-Boc-4-fluoropiperidine
pharmaceutical intermediate
Methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate
pharmaceutical intermediate compound
(R)-2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid
Pharmaceutical intermediate for ambrisentan
2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid
Pharmaceutical intermediate for impurities
1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate
AZVLZXHTXUIWRZ-VIFPVBQESA-N
CCOC(=O)[C@@H]1CC=CN1C(=O)OC(C)(C)C