This compound is a Boc-protected amine intermediate, featuring a cyclohexane ring with an aminomethyl substituent. It is primarily used in pharmaceutical manufacturing as a building block for the synthesis of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 177583-27-6
Tert-Butyl (3-(aminomethyl)cyclobutyl)carbamate
research compound for medicinal chemistry
Tert-butyl (piperidin-4-ylmethyl)carbamate
Boc-protected amine intermediate
5-methyl-1H-indazole
pharmaceutical intermediate
4-Aminocyclohexanecarboxylic acid
pharmaceutical intermediate
2-(3-hydroxyadamantan-1-yl)acetic acid
Pharmaceutical intermediate
5-Amino-2,4-ditert-butylphenol HCL
pharmaceutical intermediate
tert-butyl N-[4-(aminomethyl)cyclohexyl]carbamate
NVQFOBONHIXDOC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1CCC(CC1)CN
—