1,3-dichloro-2-methoxy-5-nitrobenzene is a chemical compound with a single aromatic ring, two chlorine substituents, a methoxy group, and a nitro group. It is structurally related to the phenethylamine 2C-N, though the provided evidence does not confirm its primary use or specific applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17742-69-7
1,3-dichloro-2-methoxy-5-nitrobenzene
GJYVJKPFYCKNEC-UHFFFAOYSA-N
COC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
—