D-Galactosamine hydrochloride is a biochemical research reagent consisting of the hydrochloride salt of the amino sugar D-galactosamine. It is commonly employed in laboratory studies to investigate liver function and metabolism due to its selective hepatotoxic effects.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1772-03-8
Udp-beta-L-rhamnose
Biochemical research reagent
4-Hydroxyisoleucine
Biochemical research reagent
5-CHLOROURACIL
Biochemical research reagent
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
Palmityl-C6 amino Phosphoramidite
lipid-based research reagent
Uridine diphosphate choline sodium salt
nucleotide sugar research reagent
Trimethylsulfoxonium iodide
Research reagent and chemical intermediate
(3R,6S,9S,12E,16S)-9-(4-Aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentaazacycloeicos-12-ene-16-carboxamide
research compound
(2R,3R,4R,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride
CBOJBBMQJBVCMW-NQZVPSPJSA-N
C([C@H]([C@@H]([C@@H]([C@H](C=O)N)O)O)O)O.Cl