Ethyltriacetoxysilane is an organosilicon compound used primarily as a cross-linking agent in silicone sealants and adhesives. It functions by reacting with moisture to cure silicone formulations, providing durability and adhesion in various applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17689-77-9
4-Chloro-3-nitrobenzenesulfonic acid, sodium salt
chemical intermediate for dyes and pigments
Methanesulfinic acid
organosulfinic acid compound
2-METHYL-2-ADAMANTYL METHACRYLATE
Methacrylate monomer for polymers
2,4-bis(phenylsulfonyl)phenol
Developer for thermal paper
[diacetyloxy(ethyl)silyl] acetate
KXJLGCBCRCSXQF-UHFFFAOYSA-N
CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C