Ethyl-d5-amine is a deuterated amine compound where all five hydrogen atoms on the ethyl group are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry, particularly in mass spectrometry and nuclear magnetic resonance spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17616-24-9
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
Methyl(2H3)ammonium chloride
Deuterated amine reference standard
Diethyl [2,2'-bipyridine]-4,4'-dicarboxylate
bipyridine ligand for coordination chemistry
4-Bromo-p-terphenyl
Research chemical for organic synthesis
5-Chlorooxindole
Research compound for pharmaceutical intermediates
1,4-Dioxane-d8
deuterated NMR reference standard
Ethylamine hydrochloride
production of resins and rubber latex
Ethanamine
Intermediate for herbicides and organic synthesis
1,1,2,2,2-pentadeuterioethanamine
QUSNBJAOOMFDIB-ZBJDZAJPSA-N
[2H]C([2H])([2H])C([2H])([2H])N