This compound is a deuterated form of 2-chlorobutane used primarily as a research reagent. Its structure incorporates nine deuterium atoms, providing a stable isotopic label for analytical and laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 175540-77-9
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol
Research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine
Research reagent for chemical synthesis
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol--hydrogen chloride (1/1)
Research compound
2-CHLOROBUTANE
Organic synthesis intermediate
2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane
BSPCSKHALVHRSR-CBZKUFJVSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])Cl