This compound is a Fmoc-protected phospho-amino acid derivative of L-threonine, featuring a benzylphospho protective group on the hydroxyl side chain. It is primarily used as an intermediate in the solid-phase synthesis of phosphopeptides for research and pharmaceutical development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 175291-56-2
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(pyridin-3-yl)propanoic acid
Pharmaceutical intermediate for peptide synthesis
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
Tert-Butyl 3-cyano-4-oxo-pyrrolidine-1-carboxylate
pharmaceutical intermediate
1,3-Cyclohexanedione, 2-acetyl-5,5-dimethyl-
pharmaceutical intermediate for synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid
phosphorylated serine building block
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxybutanoic acid
HOFDVXHILSPFNS-OSPHWJPCSA-N
C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OP(=O)(O)OCC4=CC=CC=C4