This compound is a deuterated form of thiourea, where all four hydrogen atoms on the amino groups are replaced with deuterium. It is primarily used as a labeled research compound in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17370-85-3
Benzene, (2-iodoethyl)-
research reagent
Benzyl glycinate
amino acid ester reagent
1,2-Dimethylimidazole
Research reagent and catalyst
Methyl (R)-lactate
enantiomerically pure methyl lactate
Thiocarbamide
Intermediate in chemical manufacturing
1,1,3,3-tetradeuteriothiourea
UMGDCJDMYOKAJW-JBISRTOLSA-N
[2H]N([2H])C(=S)N([2H])[2H]