This compound is a morpholine-based pharmaceutical intermediate containing multiple fluorine atoms and a chiral center. It is primarily used in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 171482-05-6
4-Methylbenzene-1-sulfonic acid--(2R,3S)-2-((1R)-1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine (1/1)
pharmaceutical intermediate
2-((1R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl) morpholine, (2R,3S)-
Nitrosamine impurity reference standard
2'-O-Propargyl g(iBu)-3'-phosphoramidite
phosphoramidite building block for oligonucleotide synthesis
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
Chloropretadalafil
pharmaceutical intermediate
8-Bromo-2'-benzamido-2'-deoxy-Adenosine
adenosine impurity reference standard
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride
DWCCMKXSGCKMJF-YNXGUESPSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F.Cl