This compound is a research compound featuring a pyrazole ring substituted with a benzyl group and a difluoromethoxy moiety. It is primarily used as a laboratory reagent for chemical and biological studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1710661-08-7
Ethane-1,1,2-d3, 1,2,2-trichloro-
deuterated reference standard
3-Methylbenzoyl chloride
chemical synthesis intermediate
Cerium(4+);bis(tetraethylazanium);hexachloride
research reagent
4-Ethoxy-1,1,1-trifluoro-3-buten-2-one
research compound
Ethyl 5-amino-1-(2-fluorobenzyl)-1H-pyrazole-3-carboxylate
pharmaceutical intermediate
1-benzyl-5-(difluoromethoxy)pyrazole-3-carboxylic acid
MGLYBLIDYKGLFA-UHFFFAOYSA-N
C1=CC=C(C=C1)CN2C(=CC(=N2)C(=O)O)OC(F)F
—