Ammonium titanium fluoride is an industrial chemical commonly used as a fluorinating agent or precursor. It occurs as a salt composed of ammonium and hexafluorotitanate ions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16962-40-6
Decaammonium tungstate
Tungsten alloy production
يوديد أمونيوم
Photographic chemicals and expectorant
كلوريد الأمونيوم
Fertilizer and soldering flux
كبريتيد الأمونيوم
Applying patina to bronze
2,2'-Dinitrodibenzyl
chemical intermediate for organic synthesis
1,7-Dicarbadodecaborane(12)
boron cluster chemistry building block
Methanol
solvent, antifreeze, chemical intermediate
Tribromomethyl phenyl sulfone
Industrial brominated sulfone reagent
diazanium;hexafluorotitanium(2-)
NMGYKLMMQCTUGI-UHFFFAOYSA-J
[NH4+].[NH4+].F[Ti-2](F)(F)(F)(F)F