This compound is a deuterated reference standard, specifically a labeled form of N-methyl-1-phenylpropan-2-amine, where multiple hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and research as an internal standard for mass spectrometry or nuclear magnetic resonance spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء هذا المركّب؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Fmoc-Phe-Gly-OH
Peptide building block
2,4-Diphenyl-6-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1,3,5-triazine
research compound
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
Bucladesine sodium
phosphodiesterase inhibitor research tool
(+/-)-Methamphetamine-d14
mass spectrometry internal standard
DL-Methamphetamine
active pharmaceutical ingredient
N,1,1,1,2,3-hexadeuterio-3-phenyl-N-(trideuteriomethyl)propan-2-amine
MYWUZJCMWCOHBA-FUUWYYHRSA-N
[2H]C(C1=CC=CC=C1)C([2H])(C([2H])([2H])[2H])N([2H])C([2H])([2H])[2H]
هل تبحث عن شراء هذا المركّب؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.