Fosbretabulin disodium is the disodium salt of a water-soluble phosphate derivative of a natural stilbenoid phenol derived from the African bush willow (Combretum caffrum). It functions as a prodrug that is dephosphorylated to the active metabolite combretastatin A4, a microtubule-depolymerizing agent that disrupts tumor vasculature, leading to reduced blood flow and ischemic necrosis in tumor tissue.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 168555-66-6
Conivaptan hydrochloride
Vasopressin receptor antagonist
(R)-5-(AZIDOMETHYL)-3-[3-FLUORO-4-(4-MORPHOLINYL)PHENYL]-2-OXAZOLIDINONE
antibiotic impurity reference standard
(5S)-5-(Aminomethyl)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxazolidinone
active pharmaceutical ingredient impurity
TAS-115 mesylate
active pharmaceutical ingredient
disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate
VXNQMUVMEIGUJW-XNOMRPDFSA-L
COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]