1-Bromo-9H-carbazole is a research reagent used primarily in carcinogenicity studies. It is classified by the International Agency for Research on Cancer (IARC) as a Group 2B substance, meaning it is possibly carcinogenic to humans based on limited human evidence and sufficient animal evidence.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16807-11-7
3-iodo-9H-carbazole
research compound
2N,2N-dietil-6-metilpiridin-2,5-diamin dihidroklorid
research compound
Ethyl 3-fluoro-1H-pyrrole-2-carboxylate
research compound
Pneumocandin M1
Micafungin impurity reference standard
1-bromo-9H-carbazole
VCDOOGZTWDOHEB-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br