This compound is a protected amino acid derivative, specifically the benzyl ester of L-isoleucine, presented as a salt with p-toluenesulfonic acid. It is commonly used as a pharmaceutical intermediate in the synthesis of peptides and other complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16652-75-8
O-Benzyl-L-valine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
L-Valine benzyl ester hydrochloride
Pharmaceutical intermediate
(R)-dimethyl 2-benzamidopentanedioate
protected amino acid derivative
4,6-dichloropyridine-3-carbonitrile
Pharmaceutical intermediate for drug synthesis
7-Desmethyl-3-hydroxyagomelatine
Pharmaceutical intermediate for agomelatine synthesis
5-Chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide
pharmaceutical intermediate
O-((Guanin-9-yl)methyl) acyclovir
Pharmaceutical intermediate
benzyl (2S,3S)-2-amino-3-methylpentanoate;4-methylbenzenesulfonic acid
XAWVXTVKSVYPNE-JGAZGGJJSA-N
CC[C@H](C)[C@@H](C(=O)OCC1=CC=CC=C1)N.CC1=CC=C(C=C1)S(=O)(=O)O