3-Chlorobromobenzene-2,4,5,6-d4 is a deuterated research compound where four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as a stable isotope-labeled reagent in analytical and synthetic chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1643577-43-8
5-bromo-2-phenyl-2H-benzo[d][1,2,3]triazole
research compound
Pyren-1-ylboronic Acid
Research reagent for boronic acid coupling
N'-[9-[(2R,4S,5S)-5-[[2-cyanoethoxy-(diisopropylamino)phosphanyl]oxymethyl]-4-(tritylamino)tetrahydrofuran-2-yl]purin-6-yl]-N,N-dimethyl-formamidine
research chemical for oligonucleotide synthesis
4-(Trifluoromethyl)phenyl isothiocyanate
isothiocyanate reagent for organic synthesis
1-Bromo-3-chlorobenzene
industrial organic synthesis intermediate
1-bromo-3-chloro-2,4,5,6-tetradeuteriobenzene
JRGGUPZKKTVKOV-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Cl)[2H]